C19H21NO4 — CID 144941786
(1R)-14-[(Z)-but-1-enyl]-5,11-dihydroxy-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one (PubChem CID 144941786) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1R)-14-[(Z)-but-1-enyl]-5,11-dihydroxy-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one.
| Compound Name | (1R)-14-[(Z)-but-1-enyl]-5,11-dihydroxy-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
|---|---|
| PubChem CID | 144941786 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (1R)-14-[(Z)-but-1-enyl]-5,11-dihydroxy-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
| SMILES | CC/C=C\C12c3c4ccc(O)c3O[C@H]1C(=O)C=CC2(O)C(NC)C4 |
| InChI | InChI=1S/C19H21NO4/c1-3-4-8-18-15-11-5-6-12(21)16(15)24-17(18)13(22)7-9-19(18,23)14(10-11)20-2/h4-9,14,17,20-21,23H,3,10H2,1-2H3/b8-4-/t14?,17-,18?,19?/m0/s1 |
| InChIKey | FIKHWSOFOIVSIX-USMOOTLCSA-N |
| XLogP | 1.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|