C7H14N2O3Pt — CID 171717451
(2-azanidylcyclohexyl)azanide;carbonic acid;platinum(2+) (PubChem CID 171717451) has the molecular formula C7H14N2O3Pt and a molecular weight of 369.28 g/mol. Its IUPAC name is (2-azanidylcyclohexyl)azanide;carbonic acid;platinum(2+).
| Compound Name | (2-azanidylcyclohexyl)azanide;carbonic acid;platinum(2+) |
|---|---|
| PubChem CID | 171717451 |
| Molecular Formula | C7H14N2O3Pt |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (2-azanidylcyclohexyl)azanide;carbonic acid;platinum(2+) |
| SMILES | O=C(O)O.[NH-]C1CCCCC1[NH-].[Pt+2] |
| InChI | InChI=1S/C6H12N2.CH2O3.Pt/c7-5-3-1-2-4-6(5)8;2-1(3)4;/h5-8H,1-4H2;(H2,2,3,4);/q-2;;+2 |
| InChIKey | OLVMZVOWVZUMMJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |