C7H10N2O4Pt — CID 138401620
(2-azanidylcyclopentyl)azanide;oxalate;platinum(4+) (PubChem CID 138401620) has the molecular formula C7H10N2O4Pt and a molecular weight of 381.25 g/mol. Its IUPAC name is (2-azanidylcyclopentyl)azanide;oxalate;platinum(4+).
| Compound Name | (2-azanidylcyclopentyl)azanide;oxalate;platinum(4+) |
|---|---|
| PubChem CID | 138401620 |
| Molecular Formula | C7H10N2O4Pt |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (2-azanidylcyclopentyl)azanide;oxalate;platinum(4+) |
| SMILES | O=C([O-])C(=O)[O-].[NH-]C1CCCC1[NH-].[Pt+4] |
| InChI | InChI=1S/C5H10N2.C2H2O4.Pt/c6-4-2-1-3-5(4)7;3-1(4)2(5)6;/h4-7H,1-3H2;(H,3,4)(H,5,6);/q-2;;+4/p-2 |
| InChIKey | NTHHJLLFTOQBOY-UHFFFAOYSA-L |
| XLogP | -1.50 |
| TPSA | 127.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|