About (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide
(2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide (PubChem CID 50909744) has the molecular formula C6H14N2O2Pt
and a molecular weight of 341.27 g/mol. Its IUPAC name is (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide.
Molecular Properties
| Compound Name | (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide |
| PubChem CID | 50909744 |
| Molecular Formula | C6H14N2O2Pt |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide |
| SMILES | [NH-]C1CCCCC1[NH-].[OH-].[OH-].[Pt+4] |
| InChI | InChI=1S/C6H12N2.2H2O.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H2;/q-2;;;+4/p-2 |
| InChIKey | MRROQYWYIJIXRU-UHFFFAOYSA-L |
| XLogP | 2.05 |
| TPSA | 107.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide?
The IUPAC name of (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide (CID 50909744) is (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide.
What is the SMILES notation for (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide?
The canonical SMILES for (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide is [NH-]C1CCCCC1[NH-].[OH-].[OH-].[Pt+4].
What is the InChIKey of (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide?
The InChIKey is MRROQYWYIJIXRU-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H12N2.2H2O.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H2;/q-2;;;+4/p-2.
What are the key properties of (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide?
(2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide has a molecular weight of 341.27 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azanidylcyclohexyl)azanide;platinum(4+);dihydroxide is sourced from PubChem (CID 50909744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).