C12H16N2O5Pt — CID 90467721
[(1R,2R)-2-azanidylcyclohexyl]azanide;3-oxocyclobutane-1,1-dicarboxylate;platinum(4+) (PubChem CID 90467721) has the molecular formula C12H16N2O5Pt and a molecular weight of 463.35 g/mol. Its IUPAC name is [(1R,2R)-2-azanidylcyclohexyl]azanide;3-oxocyclobutane-1,1-dicarboxylate;platinum(4+).
| Compound Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;3-oxocyclobutane-1,1-dicarboxylate;platinum(4+) |
|---|---|
| PubChem CID | 90467721 |
| Molecular Formula | C12H16N2O5Pt |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;3-oxocyclobutane-1,1-dicarboxylate;platinum(4+) |
| SMILES | O=C1CC(C(=O)[O-])(C(=O)[O-])C1.[NH-][C@@H]1CCCC[C@H]1[NH-].[Pt+4] |
| InChI | InChI=1S/C6H12N2.C6H6O5.Pt/c7-5-3-1-2-4-6(5)8;7-3-1-6(2-3,4(8)9)5(10)11;/h5-8H,1-4H2;1-2H2,(H,8,9)(H,10,11);/q-2;;+4/p-2/t5-,6-;;/m1../s1 |
| InChIKey | YDUKFMOTUANKRJ-BNTLRKBRSA-L |
| XLogP | -0.76 |
| TPSA | 144.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|