About [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+)
[(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) (PubChem CID 44826276) has the molecular formula C6H12I2N2Pt
and a molecular weight of 561.06 g/mol. Its IUPAC name is [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+).
Molecular Properties
| Compound Name | [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) |
| PubChem CID | 44826276 |
| Molecular Formula | C6H12I2N2Pt |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.87 |
| IUPAC Name | [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) |
| SMILES | I[Pt+2]I.[NH-]C1CCCC[C@H]1[NH-] |
| InChI | InChI=1S/C6H12N2.2HI.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H;/q-2;;;+4/p-2/t5-,6?;;;/m1.../s1 |
| InChIKey | KEZVWGKGXZSYRH-FNMUXVMQSA-L |
| XLogP | 4.17 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+)?
The IUPAC name of [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) (CID 44826276) is [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+).
What is the SMILES notation for [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+)?
The canonical SMILES for [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) is I[Pt+2]I.[NH-]C1CCCC[C@H]1[NH-].
What is the InChIKey of [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+)?
The InChIKey is KEZVWGKGXZSYRH-FNMUXVMQSA-L. The full InChI is InChI=1S/C6H12N2.2HI.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H;/q-2;;;+4/p-2/t5-,6?;;;/m1.../s1.
What are the key properties of [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+)?
[(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) has a molecular weight of 561.06 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-azanidylcyclohexyl]azanide;diiodoplatinum(2+) is sourced from PubChem (CID 44826276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).