C19H23N3O4 — CID 171719421
methyl 1,5-dioxo-3-[[(1S)-1-phenylethyl]amino]-2,9-diazaspiro[5.5]undec-3-ene-9-carboxylate (PubChem CID 171719421) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl 1,5-dioxo-3-[[(1S)-1-phenylethyl]amino]-2,9-diazaspiro[5.5]undec-3-ene-9-carboxylate.
| Compound Name | methyl 1,5-dioxo-3-[[(1S)-1-phenylethyl]amino]-2,9-diazaspiro[5.5]undec-3-ene-9-carboxylate |
|---|---|
| PubChem CID | 171719421 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | methyl 1,5-dioxo-3-[[(1S)-1-phenylethyl]amino]-2,9-diazaspiro[5.5]undec-3-ene-9-carboxylate |
| SMILES | COC(=O)N1CCC2(CC1)C(=O)C=C(N[C@@H](C)c1ccccc1)NC2=O |
| InChI | InChI=1S/C19H23N3O4/c1-13(14-6-4-3-5-7-14)20-16-12-15(23)19(17(24)21-16)8-10-22(11-9-19)18(25)26-2/h3-7,12-13,20H,8-11H2,1-2H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | KGCFFHKKTUPEQV-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|