C27H41N5O5S — CID 171721136
tert-butyl N-[[4-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]ethyl-methylcarbamoyl]phenyl]methyl]carbamate (PubChem CID 171721136) has the molecular formula C27H41N5O5S and a molecular weight of 547.72 g/mol. Its IUPAC name is tert-butyl N-[[4-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]ethyl-methylcarbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]ethyl-methylcarbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 171721136 |
| Molecular Formula | C27H41N5O5S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | tert-butyl N-[[4-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]ethyl-methylcarbamoyl]phenyl]methyl]carbamate |
| SMILES | CN(CCN(C)C(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1)C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C27H41N5O5S/c1-27(2,3)37-26(36)28-16-18-10-12-19(13-11-18)24(34)32(5)15-14-31(4)22(33)9-7-6-8-21-23-20(17-38-21)29-25(35)30-23/h10-13,20-21,23H,6-9,14-17H2,1-5H3,(H,28,36)(H2,29,30,35)/t20-,21-,23-/m0/s1 |
| InChIKey | MDWKDRRFTAZURI-FUDKSRODSA-N |
| XLogP | 2.97 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|