C25H15F4O2S+ — CID 171721890
diphenyl-[4-(2,3,4,5-tetrafluorophenoxy)carbonylphenyl]sulfanium (PubChem CID 171721890) has the molecular formula C25H15F4O2S+ and a molecular weight of 455.45 g/mol. Its IUPAC name is diphenyl-[4-(2,3,4,5-tetrafluorophenoxy)carbonylphenyl]sulfanium.
| Compound Name | diphenyl-[4-(2,3,4,5-tetrafluorophenoxy)carbonylphenyl]sulfanium |
|---|---|
| PubChem CID | 171721890 |
| Molecular Formula | C25H15F4O2S+ |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | diphenyl-[4-(2,3,4,5-tetrafluorophenoxy)carbonylphenyl]sulfanium |
| SMILES | O=C(Oc1cc(F)c(F)c(F)c1F)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H15F4O2S/c26-20-15-21(23(28)24(29)22(20)27)31-25(30)16-11-13-19(14-12-16)32(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H/q+1 |
| InChIKey | YOLFVJQACVRRJF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|