C36H54S3 — CID 171722228
1-[3,5-bis(1-adamantylsulfanyl)cyclohexyl]sulfanyladamantane (PubChem CID 171722228) has the molecular formula C36H54S3 and a molecular weight of 583.03 g/mol. Its IUPAC name is 1-[3,5-bis(1-adamantylsulfanyl)cyclohexyl]sulfanyladamantane.
| Compound Name | 1-[3,5-bis(1-adamantylsulfanyl)cyclohexyl]sulfanyladamantane |
|---|---|
| PubChem CID | 171722228 |
| Molecular Formula | C36H54S3 |
| Molecular Weight | 583.03 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | 1-[3,5-bis(1-adamantylsulfanyl)cyclohexyl]sulfanyladamantane |
| SMILES | C1C2CC3CC1CC(SC1CC(SC45CC6CC(CC(C6)C4)C5)CC(SC45CC6CC(CC(C6)C4)C5)C1)(C2)C3 |
| InChI | InChI=1S/C36H54S3/c1-22-2-24-3-23(1)14-34(13-22,15-24)37-31-10-32(38-35-16-25-4-26(17-35)6-27(5-25)18-35)12-33(11-31)39-36-19-28-7-29(20-36)9-30(8-28)21-36/h22-33H,1-21H2 |
| InChIKey | NMJRJXPILJWMIV-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.03 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |