C28H37N5O3 — CID 171722602
2-N,4-N,6-N-tris(1-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-tricarboxamide (PubChem CID 171722602) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(1-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-tricarboxamide.
| Compound Name | 2-N,4-N,6-N-tris(1-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-tricarboxamide |
|---|---|
| PubChem CID | 171722602 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 2-N,4-N,6-N-tris(1-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-tricarboxamide |
| SMILES | O=C(NC12CCC(CC1)C2)c1cc(C(=O)NC23CCC(CC2)C3)nc(C(=O)NC23CCC(CC2)C3)n1 |
| InChI | InChI=1S/C28H37N5O3/c34-23(31-26-7-1-17(14-26)2-8-26)20-13-21(24(35)32-27-9-3-18(15-27)4-10-27)30-22(29-20)25(36)33-28-11-5-19(16-28)6-12-28/h13,17-19H,1-12,14-16H2,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | QMWAHJUUUZFOEW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |