C24H28N2O6 — CID 70176185
3,4-bis(1-bicyclo[2.2.1]heptanylcarbamoyl)phthalic acid (PubChem CID 70176185) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3,4-bis(1-bicyclo[2.2.1]heptanylcarbamoyl)phthalic acid.
| Compound Name | 3,4-bis(1-bicyclo[2.2.1]heptanylcarbamoyl)phthalic acid |
|---|---|
| PubChem CID | 70176185 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3,4-bis(1-bicyclo[2.2.1]heptanylcarbamoyl)phthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)NC23CCC(CC2)C3)c(C(=O)NC23CCC(CC2)C3)c1C(=O)O |
| InChI | InChI=1S/C24H28N2O6/c27-19(25-23-7-3-13(11-23)4-8-23)15-1-2-16(21(29)30)18(22(31)32)17(15)20(28)26-24-9-5-14(12-24)6-10-24/h1-2,13-14H,3-12H2,(H,25,27)(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | LHUBEDGXNHLISE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |