C30H42N6O3 — CID 171722638
2-N,4-N,6-N-tris(1-bicyclo[2.2.2]octanyl)-1,3,5-triazine-2,4,6-tricarboxamide (PubChem CID 171722638) has the molecular formula C30H42N6O3 and a molecular weight of 534.71 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(1-bicyclo[2.2.2]octanyl)-1,3,5-triazine-2,4,6-tricarboxamide.
| Compound Name | 2-N,4-N,6-N-tris(1-bicyclo[2.2.2]octanyl)-1,3,5-triazine-2,4,6-tricarboxamide |
|---|---|
| PubChem CID | 171722638 |
| Molecular Formula | C30H42N6O3 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 2-N,4-N,6-N-tris(1-bicyclo[2.2.2]octanyl)-1,3,5-triazine-2,4,6-tricarboxamide |
| SMILES | O=C(NC12CCC(CC1)CC2)c1nc(C(=O)NC23CCC(CC2)CC3)nc(C(=O)NC23CCC(CC2)CC3)n1 |
| InChI | InChI=1S/C30H42N6O3/c37-25(34-28-10-1-19(2-11-28)3-12-28)22-31-23(26(38)35-29-13-4-20(5-14-29)6-15-29)33-24(32-22)27(39)36-30-16-7-21(8-17-30)9-18-30/h19-21H,1-18H2,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | AXFQNROJLMYNNY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |