C13H19N5O — CID 55115521
N-(1-adamantyl)-3-amino-1H-1,2,4-triazole-5-carboxamide (PubChem CID 55115521) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is N-(1-adamantyl)-3-amino-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(1-adamantyl)-3-amino-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 55115521 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-(1-adamantyl)-3-amino-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C13H19N5O/c14-12-15-10(17-18-12)11(19)16-13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6H2,(H,16,19)(H3,14,15,17,18) |
| InChIKey | OGUZTQBKDHMTTK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |