C24H46FN3 — CID 171723123
4-(1-tert-butylpiperidin-4-yl)-1-[(1-tert-butylpiperidin-4-yl)methyl]-3-fluoropiperidine (PubChem CID 171723123) has the molecular formula C24H46FN3 and a molecular weight of 395.65 g/mol. Its IUPAC name is 4-(1-tert-butylpiperidin-4-yl)-1-[(1-tert-butylpiperidin-4-yl)methyl]-3-fluoropiperidine.
| Compound Name | 4-(1-tert-butylpiperidin-4-yl)-1-[(1-tert-butylpiperidin-4-yl)methyl]-3-fluoropiperidine |
|---|---|
| PubChem CID | 171723123 |
| Molecular Formula | C24H46FN3 |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 395.37 |
| IUPAC Name | 4-(1-tert-butylpiperidin-4-yl)-1-[(1-tert-butylpiperidin-4-yl)methyl]-3-fluoropiperidine |
| SMILES | CC(C)(C)N1CCC(CN2CCC(C3CCN(C(C)(C)C)CC3)C(F)C2)CC1 |
| InChI | InChI=1S/C24H46FN3/c1-23(2,3)27-13-7-19(8-14-27)17-26-12-11-21(22(25)18-26)20-9-15-28(16-10-20)24(4,5)6/h19-22H,7-18H2,1-6H3 |
| InChIKey | OGMHPMAJKBUKHK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |