About 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine
1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine (PubChem CID 130179487) has the molecular formula C19H33F5N2
and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine |
| PubChem CID | 130179487 |
| Molecular Formula | C19H33F5N2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine |
| SMILES | CC(C)(C)N1CCC(CC(C)(C)N2CCC(C(F)(F)F)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C19H33F5N2/c1-16(2,3)26-11-8-15(18(20,21)13-26)12-17(4,5)25-9-6-14(7-10-25)19(22,23)24/h14-15H,6-13H2,1-5H3 |
| InChIKey | BVVAWWSAJKYNAE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine?
The IUPAC name of 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine (CID 130179487) is 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine.
What is the SMILES notation for 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine?
The canonical SMILES for 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine is CC(C)(C)N1CCC(CC(C)(C)N2CCC(C(F)(F)F)CC2)C(F)(F)C1.
What is the InChIKey of 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine?
The InChIKey is BVVAWWSAJKYNAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33F5N2/c1-16(2,3)26-11-8-15(18(20,21)13-26)12-17(4,5)25-9-6-14(7-10-25)19(22,23)24/h14-15H,6-13H2,1-5H3.
What are the key properties of 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine?
1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine has a molecular weight of 384.48 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,3-difluoro-4-[2-methyl-2-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine is sourced from PubChem (CID 130179487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).