C10H16O2 — CID 171726826
2,2,3,5-tetramethylhexa-3,4-dienoic acid (PubChem CID 171726826) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,2,3,5-tetramethylhexa-3,4-dienoic acid.
| Compound Name | 2,2,3,5-tetramethylhexa-3,4-dienoic acid |
|---|---|
| PubChem CID | 171726826 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2,2,3,5-tetramethylhexa-3,4-dienoic acid |
| SMILES | CC(C)=C=C(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C10H16O2/c1-7(2)6-8(3)10(4,5)9(11)12/h1-5H3,(H,11,12) |
| InChIKey | GVJOWDYTUTYICW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |