C56H50N3O4Rb — CID 171729783
4-[9-butyl-7-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-2-yl]-N,N-bis(4-methoxyphenyl)aniline;rubidium(1+) (PubChem CID 171729783) has the molecular formula C56H50N3O4Rb and a molecular weight of 914.50 g/mol. Its IUPAC name is 4-[9-butyl-7-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-2-yl]-N,N-bis(4-methoxyphenyl)aniline;rubidium(1+).
| Compound Name | 4-[9-butyl-7-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-2-yl]-N,N-bis(4-methoxyphenyl)aniline;rubidium(1+) |
|---|---|
| PubChem CID | 171729783 |
| Molecular Formula | C56H50N3O4Rb |
| Molecular Weight | 914.50 g/mol |
| Exact Mass | 913.29 |
| IUPAC Name | 4-[9-butyl-7-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-2-yl]-N,N-bis(4-methoxyphenyl)aniline;rubidium(1+) |
| SMILES | C[CH-]CCn1c2cc(-c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)ccc2c2ccc(-c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)cc21.[Rb+] |
| InChI | InChI=1S/C56H50N3O4.Rb/c1-6-7-36-57-55-37-41(39-8-14-43(15-9-39)58(45-18-26-49(60-2)27-19-45)46-20-28-50(61-3)29-21-46)12-34-53(55)54-35-13-42(38-56(54)57)40-10-16-44(17-11-40)59(47-22-30-51(62-4)31-23-47)48-24-32-52(63-5)33-25-48;/h6,8-35,37-38H,7,36H2,1-5H3;/q-1;+1 |
| InChIKey | OUODDLAIALNVCV-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.50 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|