C24H29N5O5S — CID 171731063
[2-[4-[methyl-[4-(methylsulfamoylmethyl)cyclohexyl]amino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]phenyl] acetate (PubChem CID 171731063) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is [2-[4-[methyl-[4-(methylsulfamoylmethyl)cyclohexyl]amino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]phenyl] acetate.
| Compound Name | [2-[4-[methyl-[4-(methylsulfamoylmethyl)cyclohexyl]amino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 171731063 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | [2-[4-[methyl-[4-(methylsulfamoylmethyl)cyclohexyl]amino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]phenyl] acetate |
| SMILES | CNS(=O)(=O)CC1CCC(N(C)c2ncnc3c2ccn3C(=O)c2ccccc2OC(C)=O)CC1 |
| InChI | InChI=1S/C24H29N5O5S/c1-16(30)34-21-7-5-4-6-19(21)24(31)29-13-12-20-22(26-15-27-23(20)29)28(3)18-10-8-17(9-11-18)14-35(32,33)25-2/h4-7,12-13,15,17-18,25H,8-11,14H2,1-3H3 |
| InChIKey | BNHVODCHFHYIFT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|