C16H21IN4O2 — CID 155042165
ethyl 4-[(7-iodopyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]cyclohexane-1-carboxylate (PubChem CID 155042165) has the molecular formula C16H21IN4O2 and a molecular weight of 428.27 g/mol. Its IUPAC name is ethyl 4-[(7-iodopyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(7-iodopyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155042165 |
| Molecular Formula | C16H21IN4O2 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | ethyl 4-[(7-iodopyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(N(C)c2ncnc3c2ccn3I)CC1 |
| InChI | InChI=1S/C16H21IN4O2/c1-3-23-16(22)11-4-6-12(7-5-11)20(2)14-13-8-9-21(17)15(13)19-10-18-14/h8-12H,3-7H2,1-2H3 |
| InChIKey | LEYSVNRCKOECIT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|