C35H22N3O2Pt- — CID 171732550
2-[1-methyl-4-(3-phenylisoquinolin-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum (PubChem CID 171732550) has the molecular formula C35H22N3O2Pt- and a molecular weight of 711.66 g/mol. Its IUPAC name is 2-[1-methyl-4-(3-phenylisoquinolin-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum.
| Compound Name | 2-[1-methyl-4-(3-phenylisoquinolin-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum |
|---|---|
| PubChem CID | 171732550 |
| Molecular Formula | C35H22N3O2Pt- |
| Molecular Weight | 711.66 g/mol |
| Exact Mass | 711.14 |
| IUPAC Name | 2-[1-methyl-4-(3-phenylisoquinolin-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum |
| SMILES | Cn1c(-c2cc3c(cc2O)oc2ccccc23)nc2c(-c3nc(-c4[c-]cccc4)cc4ccccc34)cccc21.[Pt] |
| InChI | InChI=1S/C35H22N3O2.Pt/c1-38-29-16-9-15-25(33-23-13-6-5-12-22(23)18-28(36-33)21-10-3-2-4-11-21)34(29)37-35(38)27-19-26-24-14-7-8-17-31(24)40-32(26)20-30(27)39;/h2-10,12-20,39H,1H3;/q-1; |
| InChIKey | SOKWVPMHOQCAOJ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.66 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|