C25H18N3OPt- — CID 171732517
2-[1-methyl-4-(3-phenylisoquinolin-1-yl)imidazol-2-yl]phenol;platinum (PubChem CID 171732517) has the molecular formula C25H18N3OPt- and a molecular weight of 571.52 g/mol. Its IUPAC name is 2-[1-methyl-4-(3-phenylisoquinolin-1-yl)imidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-methyl-4-(3-phenylisoquinolin-1-yl)imidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 171732517 |
| Molecular Formula | C25H18N3OPt- |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 2-[1-methyl-4-(3-phenylisoquinolin-1-yl)imidazol-2-yl]phenol;platinum |
| SMILES | Cn1cc(-c2nc(-c3[c-]cccc3)cc3ccccc23)nc1-c1ccccc1O.[Pt] |
| InChI | InChI=1S/C25H18N3O.Pt/c1-28-16-22(27-25(28)20-13-7-8-14-23(20)29)24-19-12-6-5-11-18(19)15-21(26-24)17-9-3-2-4-10-17;/h2-9,11-16,29H,1H3;/q-1; |
| InChIKey | HAYAXOHAZLQEEV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|