C35H28N3OPt- — CID 168843856
2-[(Z)-4-isoquinolin-4-ylbut-2-enyl]-6-(1-methyl-2-phenylimidazol-4-yl)-4-phenylphenol;platinum (PubChem CID 168843856) has the molecular formula C35H28N3OPt- and a molecular weight of 701.71 g/mol. Its IUPAC name is 2-[(Z)-4-isoquinolin-4-ylbut-2-enyl]-6-(1-methyl-2-phenylimidazol-4-yl)-4-phenylphenol;platinum.
| Compound Name | 2-[(Z)-4-isoquinolin-4-ylbut-2-enyl]-6-(1-methyl-2-phenylimidazol-4-yl)-4-phenylphenol;platinum |
|---|---|
| PubChem CID | 168843856 |
| Molecular Formula | C35H28N3OPt- |
| Molecular Weight | 701.71 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | 2-[(Z)-4-isoquinolin-4-ylbut-2-enyl]-6-(1-methyl-2-phenylimidazol-4-yl)-4-phenylphenol;platinum |
| SMILES | Cn1cc(-c2cc(-c3ccccc3)cc(C/C=C\Cc3cncc4ccccc34)c2O)nc1-c1[c-]cccc1.[Pt] |
| InChI | InChI=1S/C35H28N3O.Pt/c1-38-24-33(37-35(38)26-14-6-3-7-15-26)32-21-30(25-12-4-2-5-13-25)20-27(34(32)39)16-8-9-17-28-22-36-23-29-18-10-11-19-31(28)29;/h2-14,18-24,39H,16-17H2,1H3;/q-1;/b9-8-; |
| InChIKey | FEIFNWZRRGXECF-UOQXYWCXSA-N |
| XLogP | 7.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.71 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|