C34H26N3OPt- — CID 168843880
2-[(E)-4-isoquinolin-4-ylbut-2-enyl]-4-phenyl-6-(2-phenyl-1H-imidazol-4-yl)phenol;platinum (PubChem CID 168843880) has the molecular formula C34H26N3OPt- and a molecular weight of 687.68 g/mol. Its IUPAC name is 2-[(E)-4-isoquinolin-4-ylbut-2-enyl]-4-phenyl-6-(2-phenyl-1H-imidazol-4-yl)phenol;platinum.
| Compound Name | 2-[(E)-4-isoquinolin-4-ylbut-2-enyl]-4-phenyl-6-(2-phenyl-1H-imidazol-4-yl)phenol;platinum |
|---|---|
| PubChem CID | 168843880 |
| Molecular Formula | C34H26N3OPt- |
| Molecular Weight | 687.68 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | 2-[(E)-4-isoquinolin-4-ylbut-2-enyl]-4-phenyl-6-(2-phenyl-1H-imidazol-4-yl)phenol;platinum |
| SMILES | Oc1c(C/C=C\Cc2cncc3ccccc23)cc(-c2ccccc2)cc1-c1c[nH]c(-c2[c-]cccc2)n1.[Pt] |
| InChI | InChI=1S/C34H26N3O.Pt/c38-33-26(15-7-8-16-27-21-35-22-28-17-9-10-18-30(27)28)19-29(24-11-3-1-4-12-24)20-31(33)32-23-36-34(37-32)25-13-5-2-6-14-25;/h1-13,17-23,38H,15-16H2,(H,36,37);/q-1;/b8-7-; |
| InChIKey | BCJNLLOKUKNFAQ-CFYXSCKTSA-N |
| XLogP | 7.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|