C26H25N3Pt — CID 153483659
2-[3-(1-methyl-2-phenylimidazol-4-yl)pentan-3-yl]-6-phenylpyridine;platinum(2+) (PubChem CID 153483659) has the molecular formula C26H25N3Pt and a molecular weight of 574.59 g/mol. Its IUPAC name is 2-[3-(1-methyl-2-phenylimidazol-4-yl)pentan-3-yl]-6-phenylpyridine;platinum(2+).
| Compound Name | 2-[3-(1-methyl-2-phenylimidazol-4-yl)pentan-3-yl]-6-phenylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 153483659 |
| Molecular Formula | C26H25N3Pt |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[3-(1-methyl-2-phenylimidazol-4-yl)pentan-3-yl]-6-phenylpyridine;platinum(2+) |
| SMILES | CCC(CC)(c1cccc(-c2[c-]cccc2)n1)c1cn(C)c(-c2[c-]cccc2)n1.[Pt+2] |
| InChI | InChI=1S/C26H25N3.Pt/c1-4-26(5-2,23-18-12-17-22(27-23)20-13-8-6-9-14-20)24-19-29(3)25(28-24)21-15-10-7-11-16-21;/h6-13,15,17-19H,4-5H2,1-3H3;/q-2;+2 |
| InChIKey | HBPDPWKCFZSMPJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|