C29H23IrN3-2 — CID 170777199
iridium;10-methyl-2-phenyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-methyl-6-phenylpyridine (PubChem CID 170777199) has the molecular formula C29H23IrN3-2 and a molecular weight of 605.74 g/mol. Its IUPAC name is iridium;10-methyl-2-phenyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-methyl-6-phenylpyridine.
| Compound Name | iridium;10-methyl-2-phenyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-methyl-6-phenylpyridine |
|---|---|
| PubChem CID | 170777199 |
| Molecular Formula | C29H23IrN3-2 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | iridium;10-methyl-2-phenyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-methyl-6-phenylpyridine |
| SMILES | CC1=Cc2cccc3nc(-c4[c-]cccc4)n(c23)C1.Cc1cccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C17H13N2.C12H10N.Ir/c1-12-10-14-8-5-9-15-16(14)19(11-12)17(18-15)13-6-3-2-4-7-13;1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h2-6,8-10H,11H2,1H3;2-7,9H,1H3;/q2*-1; |
| InChIKey | MRDMWRBBTCIEFO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|