C31H27IrN3-2 — CID 170777097
iridium;2-methyl-6-phenylpyridine;2-phenyl-10-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene (PubChem CID 170777097) has the molecular formula C31H27IrN3-2 and a molecular weight of 633.80 g/mol. Its IUPAC name is iridium;2-methyl-6-phenylpyridine;2-phenyl-10-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene.
| Compound Name | iridium;2-methyl-6-phenylpyridine;2-phenyl-10-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 170777097 |
| Molecular Formula | C31H27IrN3-2 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | iridium;2-methyl-6-phenylpyridine;2-phenyl-10-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene |
| SMILES | CC(C)C1=Cc2cccc3nc(-c4[c-]cccc4)n(c23)C1.Cc1cccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C19H17N2.C12H10N.Ir/c1-13(2)16-11-15-9-6-10-17-18(15)21(12-16)19(20-17)14-7-4-3-5-8-14;1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h3-7,9-11,13H,12H2,1-2H3;2-7,9H,1H3;/q2*-1; |
| InChIKey | FPEQHLSDJWJLSC-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|