C30H25IrN3-2 — CID 170777146
iridium;2-phenyl-6-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-phenylpyridine (PubChem CID 170777146) has the molecular formula C30H25IrN3-2 and a molecular weight of 619.77 g/mol. Its IUPAC name is iridium;2-phenyl-6-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-phenylpyridine.
| Compound Name | iridium;2-phenyl-6-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-phenylpyridine |
|---|---|
| PubChem CID | 170777146 |
| Molecular Formula | C30H25IrN3-2 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | iridium;2-phenyl-6-propan-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;2-phenylpyridine |
| SMILES | CC(C)c1cc2c3c(c1)nc(-c1[c-]cccc1)n3CC=C2.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C19H17N2.C11H8N.Ir/c1-13(2)16-11-15-9-6-10-21-18(15)17(12-16)20-19(21)14-7-4-3-5-8-14;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-7,9,11-13H,10H2,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | SBPPNSHMGHRGLP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|