[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid

C23H18BNO2 — CID 171734296

IUPAC[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid
SMILESOB(O)c1cccc(-c2c(-c3ccccc3)cccc2-c2ccccc2)n1
InChIInChI=1S/C23H18BNO2/c26-24(27)22-16-8-15-21(25-22)23-19(17-9-3-1-4-10-17)13-7-14-20(23)18-11-5-2-6-12-18/h1-16,26-27H
InChIKeyABFGJJIFDSWZLG-UHFFFAOYSA-N
MW351.21 g/mol
LogP3.76
Rot. Bonds4

About [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid

[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid (PubChem CID 171734296) has the molecular formula C23H18BNO2 and a molecular weight of 351.21 g/mol. Its IUPAC name is [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid.

Molecular Properties

Compound Name[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid
PubChem CID171734296
Molecular FormulaC23H18BNO2
Molecular Weight351.21 g/mol
Exact Mass351.14
IUPAC Name[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid
SMILESOB(O)c1cccc(-c2c(-c3ccccc3)cccc2-c2ccccc2)n1
InChIInChI=1S/C23H18BNO2/c26-24(27)22-16-8-15-21(25-22)23-19(17-9-3-1-4-10-17)13-7-14-20(23)18-11-5-2-6-12-18/h1-16,26-27H
InChIKeyABFGJJIFDSWZLG-UHFFFAOYSA-N
XLogP3.76
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.21
LogP ≤ 53.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid?
The IUPAC name of [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid (CID 171734296) is [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid.
What is the SMILES notation for [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid?
The canonical SMILES for [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid is OB(O)c1cccc(-c2c(-c3ccccc3)cccc2-c2ccccc2)n1.
What is the InChIKey of [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid?
The InChIKey is ABFGJJIFDSWZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18BNO2/c26-24(27)22-16-8-15-21(25-22)23-19(17-9-3-1-4-10-17)13-7-14-20(23)18-11-5-2-6-12-18/h1-16,26-27H.
What are the key properties of [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid?
[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid has a molecular weight of 351.21 g/mol, XLogP of 3.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid is sourced from PubChem (CID 171734296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).