C23H18BNO2 — CID 171734296
[6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid (PubChem CID 171734296) has the molecular formula C23H18BNO2 and a molecular weight of 351.21 g/mol. Its IUPAC name is [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid.
| Compound Name | [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 171734296 |
| Molecular Formula | C23H18BNO2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [6-(2,6-diphenylphenyl)-2-pyridinyl]boronic acid |
| SMILES | OB(O)c1cccc(-c2c(-c3ccccc3)cccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18BNO2/c26-24(27)22-16-8-15-21(25-22)23-19(17-9-3-1-4-10-17)13-7-14-20(23)18-11-5-2-6-12-18/h1-16,26-27H |
| InChIKey | ABFGJJIFDSWZLG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|