C42H48BClN2O2 — CID 171740661
[2-(4-tert-butyl-N-[3-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-2-chlorophenyl]anilino)phenyl]boronic acid (PubChem CID 171740661) has the molecular formula C42H48BClN2O2 and a molecular weight of 659.12 g/mol. Its IUPAC name is [2-(4-tert-butyl-N-[3-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-2-chlorophenyl]anilino)phenyl]boronic acid.
| Compound Name | [2-(4-tert-butyl-N-[3-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-2-chlorophenyl]anilino)phenyl]boronic acid |
|---|---|
| PubChem CID | 171740661 |
| Molecular Formula | C42H48BClN2O2 |
| Molecular Weight | 659.12 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | [2-(4-tert-butyl-N-[3-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-2-chlorophenyl]anilino)phenyl]boronic acid |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cccc(N(c3ccc(C(C)(C)C)cc3)c3ccccc3B(O)O)c2Cl)cc1 |
| InChI | InChI=1S/C42H48BClN2O2/c1-40(2,3)29-17-23-32(24-18-29)45(33-25-19-30(20-26-33)41(4,5)6)37-15-12-16-38(39(37)44)46(36-14-11-10-13-35(36)43(47)48)34-27-21-31(22-28-34)42(7,8)9/h10-28,47-48H,1-9H3 |
| InChIKey | GNAQNFZYEFGZPM-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.12 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|