C26H29ClINS — CID 162519245
[2-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-6-chlorophenyl] thiohypoiodite (PubChem CID 162519245) has the molecular formula C26H29ClINS and a molecular weight of 549.95 g/mol. Its IUPAC name is [2-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-6-chlorophenyl] thiohypoiodite.
| Compound Name | [2-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-6-chlorophenyl] thiohypoiodite |
|---|---|
| PubChem CID | 162519245 |
| Molecular Formula | C26H29ClINS |
| Molecular Weight | 549.95 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | [2-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)-6-chlorophenyl] thiohypoiodite |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cccc(Cl)c2SI)cc1 |
| InChI | InChI=1S/C26H29ClINS/c1-25(2,3)18-10-14-20(15-11-18)29(23-9-7-8-22(27)24(23)30-28)21-16-12-19(13-17-21)26(4,5)6/h7-17H,1-6H3 |
| InChIKey | DZTFRZINEMTQPT-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.95 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|