C31H31NO — CID 171741293
2-(4-tert-butylnaphthalen-2-yl)-4-[3-(2-methylpropyl)-1-benzofuran-4-yl]pyridine (PubChem CID 171741293) has the molecular formula C31H31NO and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-(4-tert-butylnaphthalen-2-yl)-4-[3-(2-methylpropyl)-1-benzofuran-4-yl]pyridine.
| Compound Name | 2-(4-tert-butylnaphthalen-2-yl)-4-[3-(2-methylpropyl)-1-benzofuran-4-yl]pyridine |
|---|---|
| PubChem CID | 171741293 |
| Molecular Formula | C31H31NO |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-(4-tert-butylnaphthalen-2-yl)-4-[3-(2-methylpropyl)-1-benzofuran-4-yl]pyridine |
| SMILES | CC(C)Cc1coc2cccc(-c3ccnc(-c4cc(C(C)(C)C)c5ccccc5c4)c3)c12 |
| InChI | InChI=1S/C31H31NO/c1-20(2)15-24-19-33-29-12-8-11-26(30(24)29)22-13-14-32-28(18-22)23-16-21-9-6-7-10-25(21)27(17-23)31(3,4)5/h6-14,16-20H,15H2,1-5H3 |
| InChIKey | CRTIBIHSYGHHHU-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |