C21H36N2NaO4- — CID 171744606
sodium;[(2R,3S)-2-[(3-methylimidazol-4-yl)methyl]-3-(oxomethyl)pentyl] decanoate;hydroxide (PubChem CID 171744606) has the molecular formula C21H36N2NaO4- and a molecular weight of 403.52 g/mol. Its IUPAC name is sodium;[(2R,3S)-2-[(3-methylimidazol-4-yl)methyl]-3-(oxomethyl)pentyl] decanoate;hydroxide.
| Compound Name | sodium;[(2R,3S)-2-[(3-methylimidazol-4-yl)methyl]-3-(oxomethyl)pentyl] decanoate;hydroxide |
|---|---|
| PubChem CID | 171744606 |
| Molecular Formula | C21H36N2NaO4- |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | sodium;[(2R,3S)-2-[(3-methylimidazol-4-yl)methyl]-3-(oxomethyl)pentyl] decanoate;hydroxide |
| SMILES | CCCCCCCCCC(=O)OC[C@H](Cc1cncn1C)[C@@H]([C-]=O)CC.[Na+].[OH-] |
| InChI | InChI=1S/C21H35N2O3.Na.H2O/c1-4-6-7-8-9-10-11-12-21(25)26-16-19(18(5-2)15-24)13-20-14-22-17-23(20)3;;/h14,17-19H,4-13,16H2,1-3H3;;1H2/q-1;+1;/p-1/t18-,19+;;/m1../s1 |
| InChIKey | PBXMGVZGAVZROW-QNCHGCKQSA-M |
| XLogP | 1.23 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|