C40H58BrN7O3 — CID 166075390
[(3S)-3-[2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazole-1-carbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (Z)-octadec-9-enoate (PubChem CID 166075390) has the molecular formula C40H58BrN7O3 and a molecular weight of 764.85 g/mol. Its IUPAC name is [(3S)-3-[2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazole-1-carbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (Z)-octadec-9-enoate.
| Compound Name | [(3S)-3-[2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazole-1-carbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 166075390 |
| Molecular Formula | C40H58BrN7O3 |
| Molecular Weight | 764.85 g/mol |
| Exact Mass | 763.38 |
| IUPAC Name | [(3S)-3-[2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazole-1-carbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(Cc1cncn1C)[C@H](CC)C(=O)N1CCN=C1Nc1ccc2nccnc2c1Br |
| InChI | InChI=1S/C40H58BrN7O3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-36(49)51-29-31(27-32-28-42-30-47(32)3)33(5-2)39(50)48-26-25-45-40(48)46-34-21-22-35-38(37(34)41)44-24-23-43-35/h12-13,21-24,28,30-31,33H,4-11,14-20,25-27,29H2,1-3H3,(H,45,46)/b13-12-/t31?,33-/m0/s1 |
| InChIKey | VWVMBGZOLIFSDE-CMPXKDIASA-N |
| XLogP | 9.20 |
| TPSA | 114.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.85 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|