C31H54N2O2 — CID 174297259
[3-ethyl-4-methyl-2-[(3-methylimidazol-4-yl)methyl]pent-4-enyl] (Z)-octadec-9-enoate (PubChem CID 174297259) has the molecular formula C31H54N2O2 and a molecular weight of 486.79 g/mol. Its IUPAC name is [3-ethyl-4-methyl-2-[(3-methylimidazol-4-yl)methyl]pent-4-enyl] (Z)-octadec-9-enoate.
| Compound Name | [3-ethyl-4-methyl-2-[(3-methylimidazol-4-yl)methyl]pent-4-enyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 174297259 |
| Molecular Formula | C31H54N2O2 |
| Molecular Weight | 486.79 g/mol |
| Exact Mass | 486.42 |
| IUPAC Name | [3-ethyl-4-methyl-2-[(3-methylimidazol-4-yl)methyl]pent-4-enyl] (Z)-octadec-9-enoate |
| SMILES | C=C(C)C(CC)C(COC(=O)CCCCCCC/C=C\CCCCCCCC)Cc1cncn1C |
| InChI | InChI=1S/C31H54N2O2/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-31(34)35-25-28(30(7-2)27(3)4)23-29-24-32-26-33(29)5/h14-15,24,26,28,30H,3,6-13,16-23,25H2,1-2,4-5H3/b15-14- |
| InChIKey | FVUCPTIAPYZQFL-PFONDFGASA-N |
| XLogP | 8.76 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.79 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|