C42H62N4O4 — CID 166075380
[3-[[3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methoxycarbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 166075380) has the molecular formula C42H62N4O4 and a molecular weight of 686.98 g/mol. Its IUPAC name is [3-[[3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methoxycarbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[[3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methoxycarbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 166075380 |
| Molecular Formula | C42H62N4O4 |
| Molecular Weight | 686.98 g/mol |
| Exact Mass | 686.48 |
| IUPAC Name | [3-[[3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methoxycarbonyl]-2-[(3-methylimidazol-4-yl)methyl]pentyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(Cc1cncn1C)C(CC)C(=O)OCc1cccc([C@H](C)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C42H62N4O4/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-41(47)49-30-36(26-37-27-44-32-46(37)5)38(7-2)42(48)50-29-35-23-22-24-39(33(35)3)34(4)40-28-43-31-45-40/h11-12,14-15,22-24,27-28,31-32,34,36,38H,6-10,13,16-21,25-26,29-30H2,1-5H3,(H,43,45)/b12-11-,15-14-/t34-,36?,38?/m0/s1 |
| InChIKey | TWJQHJDIGPHPBY-VRBFLGJOSA-N |
| XLogP | 9.89 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.98 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|