C21H19F3N4O2 — CID 171744619
2,6-difluoro-N-(6-fluoro-8-methoxyquinolin-2-yl)-4-piperazin-1-ylbenzamide (PubChem CID 171744619) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2,6-difluoro-N-(6-fluoro-8-methoxyquinolin-2-yl)-4-piperazin-1-ylbenzamide.
| Compound Name | 2,6-difluoro-N-(6-fluoro-8-methoxyquinolin-2-yl)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 171744619 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2,6-difluoro-N-(6-fluoro-8-methoxyquinolin-2-yl)-4-piperazin-1-ylbenzamide |
| SMILES | COc1cc(F)cc2ccc(NC(=O)c3c(F)cc(N4CCNCC4)cc3F)nc12 |
| InChI | InChI=1S/C21H19F3N4O2/c1-30-17-9-13(22)8-12-2-3-18(26-20(12)17)27-21(29)19-15(23)10-14(11-16(19)24)28-6-4-25-5-7-28/h2-3,8-11,25H,4-7H2,1H3,(H,26,27,29) |
| InChIKey | MPGUVYVDJKODLT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |