C21H19FN4OS — CID 171420383
N-(4-ethynyl-1,3-benzothiazol-2-yl)-2-fluoro-6-methyl-4-piperazin-1-ylbenzamide (PubChem CID 171420383) has the molecular formula C21H19FN4OS and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(4-ethynyl-1,3-benzothiazol-2-yl)-2-fluoro-6-methyl-4-piperazin-1-ylbenzamide.
| Compound Name | N-(4-ethynyl-1,3-benzothiazol-2-yl)-2-fluoro-6-methyl-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 171420383 |
| Molecular Formula | C21H19FN4OS |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-(4-ethynyl-1,3-benzothiazol-2-yl)-2-fluoro-6-methyl-4-piperazin-1-ylbenzamide |
| SMILES | C#Cc1cccc2sc(NC(=O)c3c(C)cc(N4CCNCC4)cc3F)nc12 |
| InChI | InChI=1S/C21H19FN4OS/c1-3-14-5-4-6-17-19(14)24-21(28-17)25-20(27)18-13(2)11-15(12-16(18)22)26-9-7-23-8-10-26/h1,4-6,11-12,23H,7-10H2,2H3,(H,24,25,27) |
| InChIKey | UHMBQTBIHPEMPK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|