C21H18F2N4OS — CID 171420392
N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-[(2S)-2-methylpiperazin-1-yl]benzamide (PubChem CID 171420392) has the molecular formula C21H18F2N4OS and a molecular weight of 412.47 g/mol. Its IUPAC name is N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-[(2S)-2-methylpiperazin-1-yl]benzamide.
| Compound Name | N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-[(2S)-2-methylpiperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 171420392 |
| Molecular Formula | C21H18F2N4OS |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-[(2S)-2-methylpiperazin-1-yl]benzamide |
| SMILES | C#Cc1cccc2sc(NC(=O)c3c(F)cc(N4CCNC[C@@H]4C)cc3F)nc12 |
| InChI | InChI=1S/C21H18F2N4OS/c1-3-13-5-4-6-17-19(13)25-21(29-17)26-20(28)18-15(22)9-14(10-16(18)23)27-8-7-24-11-12(27)2/h1,4-6,9-10,12,24H,7-8,11H2,2H3,(H,25,26,28)/t12-/m0/s1 |
| InChIKey | ZEBLEKYINDUFEX-LBPRGKRZSA-N |
| XLogP | 3.61 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|