C21H39N3O2 — CID 171748853
4-N,6-N,2-tritert-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxamide (PubChem CID 171748853) has the molecular formula C21H39N3O2 and a molecular weight of 365.56 g/mol. Its IUPAC name is 4-N,6-N,2-tritert-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxamide.
| Compound Name | 4-N,6-N,2-tritert-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxamide |
|---|---|
| PubChem CID | 171748853 |
| Molecular Formula | C21H39N3O2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | 4-N,6-N,2-tritert-butyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-4,6-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC(C(=O)NC(C)(C)C)C2CN(C(C)(C)C)CC12 |
| InChI | InChI=1S/C21H39N3O2/c1-19(2,3)22-17(25)13-10-14(18(26)23-20(4,5)6)16-12-24(11-15(13)16)21(7,8)9/h13-16H,10-12H2,1-9H3,(H,22,25)(H,23,26) |
| InChIKey | YPFMCVKKMBYDEG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |