C12H22O3 — CID 171749300
2-(2,2-dimethylpropyl)-3-hydroxy-4,4-dimethylpent-2-enoic acid (PubChem CID 171749300) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-3-hydroxy-4,4-dimethylpent-2-enoic acid.
| Compound Name | 2-(2,2-dimethylpropyl)-3-hydroxy-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 171749300 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-3-hydroxy-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(C)CC(C(=O)O)=C(O)C(C)(C)C |
| InChI | InChI=1S/C12H22O3/c1-11(2,3)7-8(10(14)15)9(13)12(4,5)6/h13H,7H2,1-6H3,(H,14,15) |
| InChIKey | MNBGQKLJQGRXBW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|