4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid

C16H28O4 — CID 87445521

IUPAC4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid
SMILESC=C(CC(C)(C)C)C(=O)O.C=C(CCCCC)C(=O)O
InChIInChI=1S/2C8H14O2/c1-6(7(9)10)5-8(2,3)4;1-3-4-5-6-7(2)8(9)10/h1,5H2,2-4H3,(H,9,10);2-6H2,1H3,(H,9,10)
InChIKeyRFXRANAMCZBFGK-UHFFFAOYSA-N
MW284.40 g/mol
LogP4.27
Rot. Bonds7

About 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid

4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid (PubChem CID 87445521) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid.

Molecular Properties

Compound Name4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid
PubChem CID87445521
Molecular FormulaC16H28O4
Molecular Weight284.40 g/mol
Exact Mass284.20
IUPAC Name4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid
SMILESC=C(CC(C)(C)C)C(=O)O.C=C(CCCCC)C(=O)O
InChIInChI=1S/2C8H14O2/c1-6(7(9)10)5-8(2,3)4;1-3-4-5-6-7(2)8(9)10/h1,5H2,2-4H3,(H,9,10);2-6H2,1H3,(H,9,10)
InChIKeyRFXRANAMCZBFGK-UHFFFAOYSA-N
XLogP4.27
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 54.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid?
The IUPAC name of 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid (CID 87445521) is 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid.
What is the SMILES notation for 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid?
The canonical SMILES for 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid is C=C(CC(C)(C)C)C(=O)O.C=C(CCCCC)C(=O)O.
What is the InChIKey of 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid?
The InChIKey is RFXRANAMCZBFGK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H14O2/c1-6(7(9)10)5-8(2,3)4;1-3-4-5-6-7(2)8(9)10/h1,5H2,2-4H3,(H,9,10);2-6H2,1H3,(H,9,10).
What are the key properties of 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid?
4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid has a molecular weight of 284.40 g/mol, XLogP of 4.27, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid is sourced from PubChem (CID 87445521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).