C16H28O4 — CID 87445521
4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid (PubChem CID 87445521) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid.
| Compound Name | 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid |
|---|---|
| PubChem CID | 87445521 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneheptanoic acid |
| SMILES | C=C(CC(C)(C)C)C(=O)O.C=C(CCCCC)C(=O)O |
| InChI | InChI=1S/2C8H14O2/c1-6(7(9)10)5-8(2,3)4;1-3-4-5-6-7(2)8(9)10/h1,5H2,2-4H3,(H,9,10);2-6H2,1H3,(H,9,10) |
| InChIKey | RFXRANAMCZBFGK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|