C17H30O4 — CID 118453604
4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneoctanoic acid (PubChem CID 118453604) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneoctanoic acid.
| Compound Name | 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneoctanoic acid |
|---|---|
| PubChem CID | 118453604 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4,4-dimethyl-2-methylidenepentanoic acid;2-methylideneoctanoic acid |
| SMILES | C=C(CC(C)(C)C)C(=O)O.C=C(CCCCCC)C(=O)O |
| InChI | InChI=1S/C9H16O2.C8H14O2/c1-3-4-5-6-7-8(2)9(10)11;1-6(7(9)10)5-8(2,3)4/h2-7H2,1H3,(H,10,11);1,5H2,2-4H3,(H,9,10) |
| InChIKey | ROZHAHIDZZJCAD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|