C18H25N5O2 — CID 171753487
tert-butyl 3-[(R)-(3-aminophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]azetidine-1-carboxylate (PubChem CID 171753487) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is tert-butyl 3-[(R)-(3-aminophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(R)-(3-aminophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171753487 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | tert-butyl 3-[(R)-(3-aminophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]azetidine-1-carboxylate |
| SMILES | Cn1cnnc1[C@@H](c1cccc(N)c1)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H25N5O2/c1-18(2,3)25-17(24)23-9-13(10-23)15(16-21-20-11-22(16)4)12-6-5-7-14(19)8-12/h5-8,11,13,15H,9-10,19H2,1-4H3/t15-/m0/s1 |
| InChIKey | BIGMBSUYNINALE-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|