C15H20O7S — CID 171755866
dimethyl (2S,3R)-2-ethyl-3-(4-methylphenyl)sulfonyloxybutanedioate (PubChem CID 171755866) has the molecular formula C15H20O7S and a molecular weight of 344.39 g/mol. Its IUPAC name is dimethyl (2S,3R)-2-ethyl-3-(4-methylphenyl)sulfonyloxybutanedioate.
| Compound Name | dimethyl (2S,3R)-2-ethyl-3-(4-methylphenyl)sulfonyloxybutanedioate |
|---|---|
| PubChem CID | 171755866 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | dimethyl (2S,3R)-2-ethyl-3-(4-methylphenyl)sulfonyloxybutanedioate |
| SMILES | CC[C@H](C(=O)OC)[C@@H](OS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C15H20O7S/c1-5-12(14(16)20-3)13(15(17)21-4)22-23(18,19)11-8-6-10(2)7-9-11/h6-9,12-13H,5H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | JKNRXMAZSQMZKP-QWHCGFSZSA-N |
| XLogP | 1.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|