C32H48O3S2Si — CID 171758239
1-[tert-butyl(diphenyl)silyl]oxyoctan-2-yl 5-(dithiolan-3-yl)pentanoate (PubChem CID 171758239) has the molecular formula C32H48O3S2Si and a molecular weight of 572.95 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]oxyoctan-2-yl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]oxyoctan-2-yl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 171758239 |
| Molecular Formula | C32H48O3S2Si |
| Molecular Weight | 572.95 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]oxyoctan-2-yl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CCCCCCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C32H48O3S2Si/c1-5-6-7-10-17-27(35-31(33)23-16-15-18-28-24-25-36-37-28)26-34-38(32(2,3)4,29-19-11-8-12-20-29)30-21-13-9-14-22-30/h8-9,11-14,19-22,27-28H,5-7,10,15-18,23-26H2,1-4H3 |
| InChIKey | GMVVRKWFLAHAGH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.95 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|