C25H24F7N4O7P — CID 171759079
[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-yl]oxymethyl dihydrogen phosphate (PubChem CID 171759079) has the molecular formula C25H24F7N4O7P and a molecular weight of 656.45 g/mol. Its IUPAC name is [(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 171759079 |
| Molecular Formula | C25H24F7N4O7P |
| Molecular Weight | 656.45 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | [(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-yl]oxymethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCO[C@@](Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)C12CC(c3ccc(OC[C@@H](O)C(F)(F)F)cc3)(C1)C2 |
| InChI | InChI=1S/C25H24F7N4O7P/c26-16-3-6-18(19(27)7-16)23(12-36-13-33-34-35-36,42-14-43-44(38,39)40)25(31,32)22-9-21(10-22,11-22)15-1-4-17(5-2-15)41-8-20(37)24(28,29)30/h1-7,13,20,37H,8-12,14H2,(H2,38,39,40)/t20-,21?,22?,23+/m1/s1 |
| InChIKey | ZNFUOZYFEPCUIP-PLYUQDFWSA-N |
| XLogP | 3.99 |
| TPSA | 149.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|