C19H20ClN3OS — CID 17175932
2-(4-chlorophenyl)-N-(4-phenylpiperazine-1-carbothioyl)acetamide (PubChem CID 17175932) has the molecular formula C19H20ClN3OS and a molecular weight of 373.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(4-phenylpiperazine-1-carbothioyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-(4-phenylpiperazine-1-carbothioyl)acetamide |
|---|---|
| PubChem CID | 17175932 |
| Molecular Formula | C19H20ClN3OS |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(4-phenylpiperazine-1-carbothioyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20ClN3OS/c20-16-8-6-15(7-9-16)14-18(24)21-19(25)23-12-10-22(11-13-23)17-4-2-1-3-5-17/h1-9H,10-14H2,(H,21,24,25) |
| InChIKey | FJUQHJDKWFIKIT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|