C23H31N3O5 — CID 171763234
ethyl 3-[1,5-dimethyl-4-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrazol-3-yl]-3-oxopropanoate (PubChem CID 171763234) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 3-[1,5-dimethyl-4-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrazol-3-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[1,5-dimethyl-4-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrazol-3-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 171763234 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | ethyl 3-[1,5-dimethyl-4-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrazol-3-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1nn(C)c(C)c1Cc1ccccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C23H31N3O5/c1-4-30-22(28)16-20(27)23-19(17(2)25(3)24-23)15-18-7-5-6-8-21(18)31-14-11-26-9-12-29-13-10-26/h5-8H,4,9-16H2,1-3H3 |
| InChIKey | CPRWHDHCCRWQJC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|