C19H27N3O3 — CID 171763268
[3-ethyl-1-(trideuteriomethyl)pyrazol-4-yl]-[2-(2-morpholin-4-ylethoxy)phenyl]methanol (PubChem CID 171763268) has the molecular formula C19H27N3O3 and a molecular weight of 348.46 g/mol. Its IUPAC name is [3-ethyl-1-(trideuteriomethyl)pyrazol-4-yl]-[2-(2-morpholin-4-ylethoxy)phenyl]methanol.
| Compound Name | [3-ethyl-1-(trideuteriomethyl)pyrazol-4-yl]-[2-(2-morpholin-4-ylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 171763268 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [3-ethyl-1-(trideuteriomethyl)pyrazol-4-yl]-[2-(2-morpholin-4-ylethoxy)phenyl]methanol |
| SMILES | [2H]C([2H])([2H])n1cc(C(O)c2ccccc2OCCN2CCOCC2)c(CC)n1 |
| InChI | InChI=1S/C19H27N3O3/c1-3-17-16(14-21(2)20-17)19(23)15-6-4-5-7-18(15)25-13-10-22-8-11-24-12-9-22/h4-7,14,19,23H,3,8-13H2,1-2H3/i2D3 |
| InChIKey | NQSFMBSLCHJPGW-BMSJAHLVSA-N |
| XLogP | 1.78 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |